Products 56894-41-8

CAS 56894-41-8 is the registry number for 2-(5-(2-Chlorophenyl)-1,3,4-oxadiazol-2-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid (CAS 56894-41-8) is a chemical compound with the molecular formula C15H9ClN2O3 and a molecular weight of 300.69 g/mol. IUPAC name: 2-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid. InChIKey: GQZDHSAELUMAAQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H9ClN2O3
Molecular weight300.69 g/mol
IUPAC name2-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]benzoic acid
InChIKeyGQZDHSAELUMAAQ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=NN=C(O2)C3=CC=CC=C3Cl)C(=O)O

Computed by PubChem (NCBI)