CAS 1094269-20-1 is the registry number for 3-{(4-(Propan-2-yl)benzenesulfonyl)methyl}furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-[(4-propan-2-ylphenyl)sulfonylmethyl]furan-2-carboxylic acid (CAS 1094269-20-1) is a chemical compound with the molecular formula C15H16O5S and a molecular weight of 308.4 g/mol. IUPAC name: 3-[(4-propan-2-ylphenyl)sulfonylmethyl]furan-2-carboxylic acid. InChIKey: PIGWWANWXJCAGN-UHFFFAOYSA-N.
| Molecular formula | C15H16O5S |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 3-[(4-propan-2-ylphenyl)sulfonylmethyl]furan-2-carboxylic acid |
| InChIKey | PIGWWANWXJCAGN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)S(=O)(=O)CC2=C(OC=C2)C(=O)O |
Computed by PubChem (NCBI)