Products 1094269-20-1

CAS 1094269-20-1 is the registry number for 3-{(4-(Propan-2-yl)benzenesulfonyl)methyl}furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-[(4-propan-2-ylphenyl)sulfonylmethyl]furan-2-carboxylic acid (CAS 1094269-20-1) is a chemical compound with the molecular formula C15H16O5S and a molecular weight of 308.4 g/mol. IUPAC name: 3-[(4-propan-2-ylphenyl)sulfonylmethyl]furan-2-carboxylic acid. InChIKey: PIGWWANWXJCAGN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16O5S
Molecular weight308.4 g/mol
IUPAC name3-[(4-propan-2-ylphenyl)sulfonylmethyl]furan-2-carboxylic acid
InChIKeyPIGWWANWXJCAGN-UHFFFAOYSA-N
SMILESCC(C)C1=CC=C(C=C1)S(=O)(=O)CC2=C(OC=C2)C(=O)O

Computed by PubChem (NCBI)