Products 2218504-06-2
CAS 2218504-06-2 is the registry number for MK-2118. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
(2S)-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methyl-4-oxobutanoic acid (CAS 2218504-06-2) is a chemical compound with the molecular formula C15H16O5S and a molecular weight of 308.4 g/mol. IUPAC name: (2S)-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methyl-4-oxobutanoic acid. InChIKey: WBHPMBQELUEIIV-QMMMGPOBSA-N.
| Molecular formula | C15H16O5S |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | (2S)-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-2-methyl-4-oxobutanoic acid |
| InChIKey | WBHPMBQELUEIIV-QMMMGPOBSA-N |
| SMILES | C[C@@H](CC(=O)C1=CC2=CC(=C(C=C2S1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)