CAS 109428-53-7 appears in our catalog under these names: (2S,3As,6as)-octahydrocyclopenta[b]pyrrole-2-carboxylic acid, 95%, (2S,3As,6As)-Octahydrocyclopenta[B]Pyrrole-2-Carboxylic Acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
(2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylic acid (CAS 109428-53-7) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: (2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylic acid. InChIKey: OQHKEWIEKYQINX-ACZMJKKPSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | (2S,3aS,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylic acid |
| InChIKey | OQHKEWIEKYQINX-ACZMJKKPSA-N |
| SMILES | C1C[C@H]2C[C@H](N[C@H]2C1)C(=O)O |
Computed by PubChem (NCBI)