CAS 87679-21-8 is the registry number for (1R,3S,5R)-2-Azabicyclo(3.3.0)octane-3-carboxylic Acid. Offered by: TRC. Available pack sizes: 10mg.
(2R,3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylic acid (CAS 87679-21-8) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: (2R,3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylic acid. InChIKey: OQHKEWIEKYQINX-FSDSQADBSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | (2R,3aR,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrole-2-carboxylic acid |
| InChIKey | OQHKEWIEKYQINX-FSDSQADBSA-N |
| SMILES | C1C[C@@H]2C[C@@H](N[C@@H]2C1)C(=O)O |
Computed by PubChem (NCBI)