CAS 1094291-16-3 is the registry number for 5-(1-Chloroethyl)-3-((4-fluorophenyl)methyl)-1,2,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(1-chloroethyl)-3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazole (CAS 1094291-16-3) is a chemical compound with the molecular formula C11H10ClFN2O and a molecular weight of 240.66 g/mol. IUPAC name: 5-(1-chloroethyl)-3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazole. InChIKey: KCFTYWSJCCXBEO-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFN2O |
|---|---|
| Molecular weight | 240.66 g/mol |
| IUPAC name | 5-(1-chloroethyl)-3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazole |
| InChIKey | KCFTYWSJCCXBEO-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)CC2=CC=C(C=C2)F)Cl |
Computed by PubChem (NCBI)