Products 31011-28-6

CAS 31011-28-6 is the registry number for 6-(4-Fluorophenoxy)-3-pyridinamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

6-(4-fluorophenoxy)pyridin-3-amine;hydrochloride (CAS 31011-28-6) is a chemical compound with the molecular formula C11H10ClFN2O and a molecular weight of 240.66 g/mol. IUPAC name: 6-(4-fluorophenoxy)pyridin-3-amine;hydrochloride. InChIKey: HZUQTMORHVODRU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClFN2O
Molecular weight240.66 g/mol
IUPAC name6-(4-fluorophenoxy)pyridin-3-amine;hydrochloride
InChIKeyHZUQTMORHVODRU-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1OC2=NC=C(C=C2)N)F.Cl

Computed by PubChem (NCBI)