CAS 1094294-34-4 is the registry number for 2-Cyclopropyl-1-isobutyl-1H-benzo(d)imidazole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-cyclopropyl-1-(2-methylpropyl)benzimidazole-5-carboxylic acid (CAS 1094294-34-4) is a chemical compound with the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. IUPAC name: 2-cyclopropyl-1-(2-methylpropyl)benzimidazole-5-carboxylic acid. InChIKey: GCIQPQNRARACFX-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O2 |
|---|---|
| Molecular weight | 258.32 g/mol |
| IUPAC name | 2-cyclopropyl-1-(2-methylpropyl)benzimidazole-5-carboxylic acid |
| InChIKey | GCIQPQNRARACFX-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C2=C(C=C(C=C2)C(=O)O)N=C1C3CC3 |
Computed by PubChem (NCBI)