Products 1094294-34-4

CAS 1094294-34-4 is the registry number for 2-Cyclopropyl-1-isobutyl-1H-benzo(d)imidazole-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-cyclopropyl-1-(2-methylpropyl)benzimidazole-5-carboxylic acid (CAS 1094294-34-4) is a chemical compound with the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. IUPAC name: 2-cyclopropyl-1-(2-methylpropyl)benzimidazole-5-carboxylic acid. InChIKey: GCIQPQNRARACFX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18N2O2
Molecular weight258.32 g/mol
IUPAC name2-cyclopropyl-1-(2-methylpropyl)benzimidazole-5-carboxylic acid
InChIKeyGCIQPQNRARACFX-UHFFFAOYSA-N
SMILESCC(C)CN1C2=C(C=C(C=C2)C(=O)O)N=C1C3CC3

Computed by PubChem (NCBI)