CAS 1094296-86-2 is the registry number for 5-(2-Fluorophenyl)-1,2,4-triazin-3-amine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-(2-fluorophenyl)-1,2,4-triazin-3-amine (CAS 1094296-86-2) is a chemical compound with the molecular formula C9H7FN4 and a molecular weight of 190.18 g/mol. IUPAC name: 5-(2-fluorophenyl)-1,2,4-triazin-3-amine. InChIKey: JBYPLQMUAUUGNW-UHFFFAOYSA-N.
| Molecular formula | C9H7FN4 |
|---|---|
| Molecular weight | 190.18 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-1,2,4-triazin-3-amine |
| InChIKey | JBYPLQMUAUUGNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=NC(=N2)N)F |
Computed by PubChem (NCBI)