CAS 19015-63-5 is the registry number for 1-(4-Fluorophenyl)-N-(4H-1,2,4-triazol-4-yl)methanimine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(4-fluorophenyl)-N-(1,2,4-triazol-4-yl)methanimine (CAS 19015-63-5) is a chemical compound with the molecular formula C9H7FN4 and a molecular weight of 190.18 g/mol. IUPAC name: (E)-1-(4-fluorophenyl)-N-(1,2,4-triazol-4-yl)methanimine. InChIKey: KSAZKJYZXLBFPA-WLRTZDKTSA-N.
| Molecular formula | C9H7FN4 |
|---|---|
| Molecular weight | 190.18 g/mol |
| IUPAC name | (E)-1-(4-fluorophenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| InChIKey | KSAZKJYZXLBFPA-WLRTZDKTSA-N |
| SMILES | C1=CC(=CC=C1/C=N/N2C=NN=C2)F |
Computed by PubChem (NCBI)