CAS 1094311-67-7 is the registry number for 2–(4–(Trifluoromethyl)phenyl)pyrimidin–5–amine. Offered by: GLPBio. Available pack sizes: 100mg.
2-[4-(trifluoromethyl)phenyl]pyrimidin-5-amine (CAS 1094311-67-7) is a chemical compound with the molecular formula C11H8F3N3 and a molecular weight of 239.20 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]pyrimidin-5-amine. InChIKey: VHJVKEFNWVQJNW-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N3 |
|---|---|
| Molecular weight | 239.20 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]pyrimidin-5-amine |
| InChIKey | VHJVKEFNWVQJNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(C=N2)N)C(F)(F)F |
Computed by PubChem (NCBI)