CAS 902745-40-8 is the registry number for 5-(Trifluoromethyl)(3,3′-bipyridin)-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
3-pyridin-3-yl-5-(trifluoromethyl)pyridin-2-amine (CAS 902745-40-8) is a chemical compound with the molecular formula C11H8F3N3 and a molecular weight of 239.20 g/mol. IUPAC name: 3-pyridin-3-yl-5-(trifluoromethyl)pyridin-2-amine. InChIKey: ZVOUMHLFMUESCX-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N3 |
|---|---|
| Molecular weight | 239.20 g/mol |
| IUPAC name | 3-pyridin-3-yl-5-(trifluoromethyl)pyridin-2-amine |
| InChIKey | ZVOUMHLFMUESCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=C(N=CC(=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)