CAS 1094318-23-6 is the registry number for 5-(2-Bromophenyl)-2-(chloromethyl)-1,3-oxazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(2-bromophenyl)-2-(chloromethyl)-1,3-oxazole (CAS 1094318-23-6) is a chemical compound with the molecular formula C10H7BrClNO and a molecular weight of 272.52 g/mol. IUPAC name: 5-(2-bromophenyl)-2-(chloromethyl)-1,3-oxazole. InChIKey: BEHSDYLLRZGQEE-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClNO |
|---|---|
| Molecular weight | 272.52 g/mol |
| IUPAC name | 5-(2-bromophenyl)-2-(chloromethyl)-1,3-oxazole |
| InChIKey | BEHSDYLLRZGQEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=C(O2)CCl)Br |
Computed by PubChem (NCBI)