CAS 1094318-38-3 is the registry number for 2-(1-Chloroethyl)-5-(4-fluorophenyl)-1,3-oxazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1-chloroethyl)-5-(4-fluorophenyl)-1,3-oxazole (CAS 1094318-38-3) is a chemical compound with the molecular formula C11H9ClFNO and a molecular weight of 225.64 g/mol. IUPAC name: 2-(1-chloroethyl)-5-(4-fluorophenyl)-1,3-oxazole. InChIKey: LUCKCSQWLOVHJS-UHFFFAOYSA-N.
| Molecular formula | C11H9ClFNO |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 2-(1-chloroethyl)-5-(4-fluorophenyl)-1,3-oxazole |
| InChIKey | LUCKCSQWLOVHJS-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(O1)C2=CC=C(C=C2)F)Cl |
Computed by PubChem (NCBI)