Products 1094326-11-0
CAS 1094326-11-0 appears in our catalog under these names: 4-Methoxy-3-((3-methyl-1,2-oxazol-5-yl)methanesulfonyl)benzoic acid, 95%, 4-Methoxy-3-((3-methyl-1,2-oxazol-5-yl)methanesulfonyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-methoxy-3-[(3-methyl-1,2-oxazol-5-yl)methylsulfonyl]benzoic acid (CAS 1094326-11-0) is a chemical compound with the molecular formula C13H13NO6S and a molecular weight of 311.31 g/mol. IUPAC name: 4-methoxy-3-[(3-methyl-1,2-oxazol-5-yl)methylsulfonyl]benzoic acid. InChIKey: QXOHUSOJDPRZNW-UHFFFAOYSA-N.
| Molecular formula | C13H13NO6S |
|---|---|
| Molecular weight | 311.31 g/mol |
| IUPAC name | 4-methoxy-3-[(3-methyl-1,2-oxazol-5-yl)methylsulfonyl]benzoic acid |
| InChIKey | QXOHUSOJDPRZNW-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)CS(=O)(=O)C2=C(C=CC(=C2)C(=O)O)OC |
Computed by PubChem (NCBI)