CAS 355810-85-4 appears in our catalog under these names: 2-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)-4-methanesulfonylbutanoic acid, 95%, 2-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)-4-methanesulfonylbutanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoic acid (CAS 355810-85-4) is a chemical compound with the molecular formula C13H13NO6S and a molecular weight of 311.31 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoic acid. InChIKey: LHFMZTWTJXSQGK-UHFFFAOYSA-N.
| Molecular formula | C13H13NO6S |
|---|---|
| Molecular weight | 311.31 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-4-methylsulfonylbutanoic acid |
| InChIKey | LHFMZTWTJXSQGK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCC(C(=O)O)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)