Products 1094347-07-5
CAS 1094347-07-5 appears in our catalog under these names: 3-{((pyridin-2-yl)methyl)amino}benzoic acid, 95%, 3-{((Pyridin-2-yl)methyl)amino}benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-(pyridin-2-ylmethylamino)benzoic acid (CAS 1094347-07-5) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 3-(pyridin-2-ylmethylamino)benzoic acid. InChIKey: XOILKTOEBUSZDU-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 3-(pyridin-2-ylmethylamino)benzoic acid |
| InChIKey | XOILKTOEBUSZDU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)