CAS 1094355-58-4 appears in our catalog under these names: N'-Hydroxy-3-phenoxybenzene-1-carboximidamide, 95%, N'-Hydroxy-3-phenoxybenzene-1-carboximidamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
N'-hydroxy-3-phenoxybenzenecarboximidamide (CAS 1094355-58-4) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: N'-hydroxy-3-phenoxybenzenecarboximidamide. InChIKey: RKBWADNKPGUSSV-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | N'-hydroxy-3-phenoxybenzenecarboximidamide |
| InChIKey | RKBWADNKPGUSSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)/C(=N/O)/N |
Computed by PubChem (NCBI)