Products 1094368-55-4
CAS 1094368-55-4 is the registry number for 2-(1H-1,2,4-Triazol-1-yl)-5-(trifluoromethyl)benzonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)benzonitrile (CAS 1094368-55-4) is a chemical compound with the molecular formula C10H5F3N4 and a molecular weight of 238.17 g/mol. IUPAC name: 2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)benzonitrile. InChIKey: ZHVMWTCBTXFGGR-UHFFFAOYSA-N.
| Molecular formula | C10H5F3N4 |
|---|---|
| Molecular weight | 238.17 g/mol |
| IUPAC name | 2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)benzonitrile |
| InChIKey | ZHVMWTCBTXFGGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C#N)N2C=NC=N2 |
Computed by PubChem (NCBI)