CAS 3720-41-0 is the registry number for (aza((3-(trifluoromethyl)phenyl)amino)methylene)methane-1,1-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile (CAS 3720-41-0) is a chemical compound with the molecular formula C10H5F3N4 and a molecular weight of 238.17 g/mol. IUPAC name: 2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile. InChIKey: CFVQWSSWYUKQAR-UHFFFAOYSA-N.
| Molecular formula | C10H5F3N4 |
|---|---|
| Molecular weight | 238.17 g/mol |
| IUPAC name | 2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]propanedinitrile |
| InChIKey | CFVQWSSWYUKQAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NN=C(C#N)C#N)C(F)(F)F |
Computed by PubChem (NCBI)