Products 1094373-33-7
CAS 1094373-33-7 is the registry number for 5-Methyl-1-(4-(propan-2-yloxy)phenyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxylic acid (CAS 1094373-33-7) is a chemical compound with the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. IUPAC name: 5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxylic acid. InChIKey: WZGFDGKKMZQMIB-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O3 |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | 5-methyl-1-(4-propan-2-yloxyphenyl)triazole-4-carboxylic acid |
| InChIKey | WZGFDGKKMZQMIB-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=C(C=C2)OC(C)C)C(=O)O |
Computed by PubChem (NCBI)