CAS 1217707-22-6 is the registry number for (2S)-3-Methyl-2-(4-oxo-1,2,3-benzotriazin-3(4h)-yl)pentanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2S,3R)-3-methyl-2-(4-oxo-1,2,3-benzotriazin-3-yl)pentanoic acid (CAS 1217707-22-6) is a chemical compound with the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. IUPAC name: (2S,3R)-3-methyl-2-(4-oxo-1,2,3-benzotriazin-3-yl)pentanoic acid. InChIKey: NTNMVFQETBLBRH-KCJUWKMLSA-N.
| Molecular formula | C13H15N3O3 |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | (2S,3R)-3-methyl-2-(4-oxo-1,2,3-benzotriazin-3-yl)pentanoic acid |
| InChIKey | NTNMVFQETBLBRH-KCJUWKMLSA-N |
| SMILES | CC[C@@H](C)[C@@H](C(=O)O)N1C(=O)C2=CC=CC=C2N=N1 |
Computed by PubChem (NCBI)