CAS 1094456-13-9 appears in our catalog under these names: 2-(2-Phenyl-2H-1,2,3-triazol-4-yl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(2-Phenyl-2H-1,2,3-triazol-4-yl)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(2-phenyltriazol-4-yl)-1,3-thiazole-4-carboxylic acid (CAS 1094456-13-9) is a chemical compound with the molecular formula C12H8N4O2S and a molecular weight of 272.28 g/mol. IUPAC name: 2-(2-phenyltriazol-4-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: CCVIAGQMPFKJNE-UHFFFAOYSA-N.
| Molecular formula | C12H8N4O2S |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | 2-(2-phenyltriazol-4-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | CCVIAGQMPFKJNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2N=CC(=N2)C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)