Products 2768474-30-0
CAS 2768474-30-0 is the registry number for Haspin-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methylsulfanyl-10-nitropyrido[3,4-g]quinazoline (CAS 2768474-30-0) is a chemical compound with the molecular formula C12H8N4O2S and a molecular weight of 272.28 g/mol. IUPAC name: 2-methylsulfanyl-10-nitropyrido[3,4-g]quinazoline. InChIKey: FAEYQDREFVLABR-UHFFFAOYSA-N.
| Molecular formula | C12H8N4O2S |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | 2-methylsulfanyl-10-nitropyrido[3,4-g]quinazoline |
| InChIKey | FAEYQDREFVLABR-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C=C3C=NC=CC3=C(C2=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)