CAS 1094456-73-1 appears in our catalog under these names: 3,5,6-Trimethyl-1-benzothiophene-2-carboxylic acid, 3,5,6-Trimethyl-1-benzothiophene-2-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
3,5,6-trimethyl-1-benzothiophene-2-carboxylic acid (CAS 1094456-73-1) is a chemical compound with the molecular formula C12H12O2S and a molecular weight of 220.29 g/mol. IUPAC name: 3,5,6-trimethyl-1-benzothiophene-2-carboxylic acid. InChIKey: CLGVPJKKIFLXCK-UHFFFAOYSA-N.
| Molecular formula | C12H12O2S |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 3,5,6-trimethyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | CLGVPJKKIFLXCK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)SC(=C2C)C(=O)O |
Computed by PubChem (NCBI)