Products 24444-97-1
CAS 24444-97-1 is the registry number for 4-(1-Benzothiophen-3-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-(1-benzothiophen-3-yl)butanoic acid (CAS 24444-97-1) is a chemical compound with the molecular formula C12H12O2S and a molecular weight of 220.29 g/mol. IUPAC name: 4-(1-benzothiophen-3-yl)butanoic acid. InChIKey: NHPNSMHPYFWPLZ-UHFFFAOYSA-N.
| Molecular formula | C12H12O2S |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 4-(1-benzothiophen-3-yl)butanoic acid |
| InChIKey | NHPNSMHPYFWPLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)CCCC(=O)O |
Computed by PubChem (NCBI)