CAS 1094481-17-0 appears in our catalog under these names: 3-Amino-1-{(3-(trifluoromethyl)phenyl)methyl}urea, 95%, 3-Amino-1-{(3-(trifluoromethyl)phenyl)methyl}urea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-amino-3-[[3-(trifluoromethyl)phenyl]methyl]urea (CAS 1094481-17-0) is a chemical compound with the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. IUPAC name: 1-amino-3-[[3-(trifluoromethyl)phenyl]methyl]urea. InChIKey: UYCCSNYUCWJHSH-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N3O |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 1-amino-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
| InChIKey | UYCCSNYUCWJHSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CNC(=O)NN |
Computed by PubChem (NCBI)