CAS 325720-96-5 appears in our catalog under these names: 2-{(3-(trifluoromethyl)phenyl)amino}acetohydrazide, 95%, 2-{(3-(Trifluoromethyl)phenyl)amino}acetohydrazide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-[3-(trifluoromethyl)anilino]acetohydrazide (CAS 325720-96-5) is a chemical compound with the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. IUPAC name: 2-[3-(trifluoromethyl)anilino]acetohydrazide. InChIKey: BOGMWLKAYHXRGR-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N3O |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)anilino]acetohydrazide |
| InChIKey | BOGMWLKAYHXRGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NCC(=O)NN)C(F)(F)F |
Computed by PubChem (NCBI)