CAS 109459-28-1 is the registry number for 3-Oxocyclohex-1-en-1-yl trifluoromethanesulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3-oxocyclohexen-1-yl) trifluoromethanesulfonate (CAS 109459-28-1) is a chemical compound with the molecular formula C7H7F3O4S and a molecular weight of 244.19 g/mol. IUPAC name: (3-oxocyclohexen-1-yl) trifluoromethanesulfonate. InChIKey: FHJYHLPYGBAQKI-UHFFFAOYSA-N.
| Molecular formula | C7H7F3O4S |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | (3-oxocyclohexen-1-yl) trifluoromethanesulfonate |
| InChIKey | FHJYHLPYGBAQKI-UHFFFAOYSA-N |
| SMILES | C1CC(=CC(=O)C1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)