CAS 2891971-26-7 is the registry number for 2-Oxaspiro[3.3]hept-5-en-6-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxaspiro[3.3]hept-6-en-6-yl trifluoromethanesulfonate (CAS 2891971-26-7) is a chemical compound with the molecular formula C7H7F3O4S and a molecular weight of 244.19 g/mol. IUPAC name: 2-oxaspiro[3.3]hept-6-en-6-yl trifluoromethanesulfonate. InChIKey: ZJCVMGMCPLJKKO-UHFFFAOYSA-N.
| Molecular formula | C7H7F3O4S |
|---|---|
| Molecular weight | 244.19 g/mol |
| IUPAC name | 2-oxaspiro[3.3]hept-6-en-6-yl trifluoromethanesulfonate |
| InChIKey | ZJCVMGMCPLJKKO-UHFFFAOYSA-N |
| SMILES | C1C(=CC12COC2)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)