Products 109461-15-6
CAS 109461-15-6 is the registry number for Zolpidem 6-Carboxylic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
3-[2-(dimethylamino)-2-oxoethyl]-2-(4-methylphenyl)imidazo[1,2-a]pyridine-6-carboxylic acid (CAS 109461-15-6) is a chemical compound with the molecular formula C19H19N3O3 and a molecular weight of 337.4 g/mol. IUPAC name: 3-[2-(dimethylamino)-2-oxoethyl]-2-(4-methylphenyl)imidazo[1,2-a]pyridine-6-carboxylic acid. InChIKey: RFUGIBAONXDHRM-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O3 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 3-[2-(dimethylamino)-2-oxoethyl]-2-(4-methylphenyl)imidazo[1,2-a]pyridine-6-carboxylic acid |
| InChIKey | RFUGIBAONXDHRM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(N3C=C(C=CC3=N2)C(=O)O)CC(=O)N(C)C |
Computed by PubChem (NCBI)