CAS 109461-65-6 appears in our catalog under these names: Zolpidem Phenyl-4-Carboxylic Acid, Zolpidem Impurity 53, Zolpidem Phenyl-4-carboxylic Acid (1 mg/mL in 1:1 acetonitrile:water), Zolpidem Phenyl-4-carboxylic Acid, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1x1ml, 1mg.
4-[3-[2-(dimethylamino)-2-oxoethyl]-6-methylimidazo[1,2-a]pyridin-2-yl]benzoic acid (CAS 109461-65-6) is a chemical compound with the molecular formula C19H19N3O3 and a molecular weight of 337.4 g/mol. IUPAC name: 4-[3-[2-(dimethylamino)-2-oxoethyl]-6-methylimidazo[1,2-a]pyridin-2-yl]benzoic acid. InChIKey: FELZONDEFBLTSP-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O3 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 4-[3-[2-(dimethylamino)-2-oxoethyl]-6-methylimidazo[1,2-a]pyridin-2-yl]benzoic acid |
| InChIKey | FELZONDEFBLTSP-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NC(=C2CC(=O)N(C)C)C3=CC=C(C=C3)C(=O)O)C=C1 |
Computed by PubChem (NCBI)