Products 1189868-12-9
CAS 1189868-12-9 appears in our catalog under these names: Zolpidem-d6 Phenyl-4-carboxylic Acid, Zolpidem-d6 Phenyl-4-carboxylic Acid, >95% (HPLC), Zolpidem phenyl-4-carboxylic acid-d6. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 10 mg, 1 mg.
4-[3-[2-[bis(trideuteriomethyl)amino]-2-oxoethyl]-6-methylimidazo[1,2-a]pyridin-2-yl]benzoic acid (CAS 1189868-12-9) is a chemical compound with the molecular formula C19H19N3O3 and a molecular weight of 343.4 g/mol. IUPAC name: 4-[3-[2-[bis(trideuteriomethyl)amino]-2-oxoethyl]-6-methylimidazo[1,2-a]pyridin-2-yl]benzoic acid. InChIKey: FELZONDEFBLTSP-XERRXZQWSA-N.
| Molecular formula | C19H19N3O3 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 4-[3-[2-[bis(trideuteriomethyl)amino]-2-oxoethyl]-6-methylimidazo[1,2-a]pyridin-2-yl]benzoic acid |
| InChIKey | FELZONDEFBLTSP-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(C(=O)CC1=C(N=C2N1C=C(C=C2)C)C3=CC=C(C=C3)C(=O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Zolpidem-d6 Phenyl-4-carboxylic Acid