Products 1094631-19-2

CAS 1094631-19-2 is the registry number for 2-((4-Fluoro-3-nitrophenyl)sulfamoyl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(4-fluoro-3-nitrophenyl)sulfamoyl]acetic acid (CAS 1094631-19-2) is a chemical compound with the molecular formula C8H7FN2O6S and a molecular weight of 278.22 g/mol. IUPAC name: 2-[(4-fluoro-3-nitrophenyl)sulfamoyl]acetic acid. InChIKey: VFZPNUBIVXEULE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FN2O6S
Molecular weight278.22 g/mol
IUPAC name2-[(4-fluoro-3-nitrophenyl)sulfamoyl]acetic acid
InChIKeyVFZPNUBIVXEULE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1NS(=O)(=O)CC(=O)O)[N+](=O)[O-])F

Computed by PubChem (NCBI)