Products 1803600-76-1

CAS 1803600-76-1 is the registry number for Methyl N-(4-(fluorosulfonyl)-2-nitrophenyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl N-(4-fluorosulfonyl-2-nitrophenyl)carbamate (CAS 1803600-76-1) is a chemical compound with the molecular formula C8H7FN2O6S and a molecular weight of 278.22 g/mol. IUPAC name: methyl N-(4-fluorosulfonyl-2-nitrophenyl)carbamate. InChIKey: UTLQLASZQNUHSM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FN2O6S
Molecular weight278.22 g/mol
IUPAC namemethyl N-(4-fluorosulfonyl-2-nitrophenyl)carbamate
InChIKeyUTLQLASZQNUHSM-UHFFFAOYSA-N
SMILESCOC(=O)NC1=C(C=C(C=C1)S(=O)(=O)F)[N+](=O)[O-]

Computed by PubChem (NCBI)