Products 1094661-79-6

CAS 1094661-79-6 is the registry number for 2-(Cyclopentyl(methyl)amino)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[cyclopentyl(methyl)amino]pyridine-4-carboxylic acid (CAS 1094661-79-6) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: 2-[cyclopentyl(methyl)amino]pyridine-4-carboxylic acid. InChIKey: ISJIJBHDNQFRTO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16N2O2
Molecular weight220.27 g/mol
IUPAC name2-[cyclopentyl(methyl)amino]pyridine-4-carboxylic acid
InChIKeyISJIJBHDNQFRTO-UHFFFAOYSA-N
SMILESCN(C1CCCC1)C2=NC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)