CAS 1094671-84-7 is the registry number for 2,6-Dibromo-4-fluorobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,6-dibromo-4-fluorobenzenesulfonamide (CAS 1094671-84-7) is a chemical compound with the molecular formula C6H4Br2FNO2S and a molecular weight of 332.98 g/mol. IUPAC name: 2,6-dibromo-4-fluorobenzenesulfonamide. InChIKey: FZFWDEMEGSUZQP-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2FNO2S |
|---|---|
| Molecular weight | 332.98 g/mol |
| IUPAC name | 2,6-dibromo-4-fluorobenzenesulfonamide |
| InChIKey | FZFWDEMEGSUZQP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)S(=O)(=O)N)Br)F |
Computed by PubChem (NCBI)