CAS 1208075-54-0 is the registry number for 4,5-Dibromo-2-fluorobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4,5-dibromo-2-fluorobenzenesulfonamide (CAS 1208075-54-0) is a chemical compound with the molecular formula C6H4Br2FNO2S and a molecular weight of 332.98 g/mol. IUPAC name: 4,5-dibromo-2-fluorobenzenesulfonamide. InChIKey: IIOHLLGONPQJFO-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2FNO2S |
|---|---|
| Molecular weight | 332.98 g/mol |
| IUPAC name | 4,5-dibromo-2-fluorobenzenesulfonamide |
| InChIKey | IIOHLLGONPQJFO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)S(=O)(=O)N)F |
Computed by PubChem (NCBI)