CAS 109482-98-6 is the registry number for (1E,4E)-1-(Dimethylamino)-5-(2-furyl)penta-1,4-dien-3-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(1E,4E)-1-(dimethylamino)-5-(furan-2-yl)penta-1,4-dien-3-one (CAS 109482-98-6) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (1E,4E)-1-(dimethylamino)-5-(furan-2-yl)penta-1,4-dien-3-one. InChIKey: STTKYJIVUBORTF-BSWSSELBSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (1E,4E)-1-(dimethylamino)-5-(furan-2-yl)penta-1,4-dien-3-one |
| InChIKey | STTKYJIVUBORTF-BSWSSELBSA-N |
| SMILES | CN(C)/C=C/C(=O)/C=C/C1=CC=CO1 |
Computed by PubChem (NCBI)