CAS 1094858-93-1 is the registry number for N-ethyl-2-fluoro-5-nitrobenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-ethyl-2-fluoro-5-nitrobenzenesulfonamide (CAS 1094858-93-1) is a chemical compound with the molecular formula C8H9FN2O4S and a molecular weight of 248.23 g/mol. IUPAC name: N-ethyl-2-fluoro-5-nitrobenzenesulfonamide. InChIKey: RYLZLMQAPRFIML-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O4S |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | N-ethyl-2-fluoro-5-nitrobenzenesulfonamide |
| InChIKey | RYLZLMQAPRFIML-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=C(C=CC(=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)