CAS 143790-05-0 is the registry number for Emtricitabine Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidine-2,4-dione (CAS 143790-05-0) is a chemical compound with the molecular formula C8H9FN2O4S and a molecular weight of 248.23 g/mol. IUPAC name: 5-fluoro-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidine-2,4-dione. InChIKey: KOGYOPLNKQJQFM-RITPCOANSA-N.
| Molecular formula | C8H9FN2O4S |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 5-fluoro-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidine-2,4-dione |
| InChIKey | KOGYOPLNKQJQFM-RITPCOANSA-N |
| SMILES | C1[C@@H](O[C@@H](S1)CO)N2C=C(C(=O)NC2=O)F |
Computed by PubChem (NCBI)