Products 1095036-68-2

CAS 1095036-68-2 is the registry number for 4-Bromo-2-butoxybenzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-bromo-2-butoxybenzoic acid (CAS 1095036-68-2) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: 4-bromo-2-butoxybenzoic acid. InChIKey: VRNOHFRLCNKSPB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13BrO3
Molecular weight273.12 g/mol
IUPAC name4-bromo-2-butoxybenzoic acid
InChIKeyVRNOHFRLCNKSPB-UHFFFAOYSA-N
SMILESCCCCOC1=C(C=CC(=C1)Br)C(=O)O

Computed by PubChem (NCBI)