CAS 1095080-29-7 appears in our catalog under these names: 2-(1H-Benzimidazol-1-yl)propanoic acid hydrochloride, 95%, 2-Benzoimidazol-1-yl-propionic acid hydrochloride, 2-(1H-benzimidazol-1-yl)propanoic acid hydrochloride. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 1g, 5g.
2-(benzimidazol-1-yl)propanoic acid;hydrochloride (CAS 1095080-29-7) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: 2-(benzimidazol-1-yl)propanoic acid;hydrochloride. InChIKey: AMZUAAZMVMIKPW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2 |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | 2-(benzimidazol-1-yl)propanoic acid;hydrochloride |
| InChIKey | AMZUAAZMVMIKPW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C=NC2=CC=CC=C21.Cl |
Computed by PubChem (NCBI)