CAS 82417-84-3 is the registry number for Methyl chloro[(4-methylphenyl)hydrazono]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Methyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate (CAS 82417-84-3) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: methyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate. InChIKey: VUTXHTQBRCBFCL-LCYFTJDESA-N.
| Molecular formula | C10H11ClN2O2 |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | methyl (2Z)-2-chloro-2-[(4-methylphenyl)hydrazinylidene]acetate |
| InChIKey | VUTXHTQBRCBFCL-LCYFTJDESA-N |
| SMILES | CC1=CC=C(C=C1)N/N=C(/C(=O)OC)\Cl |
Computed by PubChem (NCBI)