CAS 1095274-55-7 appears in our catalog under these names: Ethyl 3-bromo-5-chlorobenzoate, 97%, 97%, Ethyl 3-bromo-5-chlorobenzoate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
Ethyl 3-bromo-5-chlorobenzoate (CAS 1095274-55-7) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: ethyl 3-bromo-5-chlorobenzoate. InChIKey: PQIMKYGTOMCPME-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | ethyl 3-bromo-5-chlorobenzoate |
| InChIKey | PQIMKYGTOMCPME-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)