CAS 109537-11-3 appears in our catalog under these names: Loratadine Impurity 29, Loratadine Impurity 37, Loratadine Impurity 19, 8-Dechloro-9-chloro Loratadine, 8–Dechloro–9–chloro loratadine. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1mg.
Ethyl 4-(14-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (CAS 109537-11-3) is a chemical compound with the molecular formula C22H23ClN2O2 and a molecular weight of 382.9 g/mol. IUPAC name: ethyl 4-(14-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate. InChIKey: BTRWFDJXJHWGSK-UHFFFAOYSA-N.
| Molecular formula | C22H23ClN2O2 |
|---|---|
| Molecular weight | 382.9 g/mol |
| IUPAC name | ethyl 4-(14-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| InChIKey | BTRWFDJXJHWGSK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(=C2C3=C(CCC4=C2N=CC=C4)C=CC(=C3)Cl)CC1 |
Computed by PubChem (NCBI)