CAS 1398065-63-8 appears in our catalog under these names: Loratadine-d5 (ethyl-d5), Loratadine-d5 (ethyl-d5), 99 atom % D, min 98% Chemical Purity, Loratadine-d5, 99.96%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 10 mg, 5 mg, 1 mg.
1,1,2,2,2-pentadeuterioethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate (CAS 1398065-63-8) is a chemical compound with the molecular formula C22H23ClN2O2 and a molecular weight of 387.9 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterioethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate. InChIKey: JCCNYMKQOSZNPW-ZBJDZAJPSA-N.
| Molecular formula | C22H23ClN2O2 |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterioethyl 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidine-1-carboxylate |
| InChIKey | JCCNYMKQOSZNPW-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)N1CCC(=C2C3=C(CCC4=C2N=CC=C4)C=C(C=C3)Cl)CC1 |
Computed by PubChem (NCBI)