Products 1095503-57-3
CAS 1095503-57-3 is the registry number for 5-{((2-Chlorophenyl)methyl)sulfanyl}pyridin-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(2-chlorophenyl)methylsulfanyl]pyridin-2-amine (CAS 1095503-57-3) is a chemical compound with the molecular formula C12H11ClN2S and a molecular weight of 250.75 g/mol. IUPAC name: 5-[(2-chlorophenyl)methylsulfanyl]pyridin-2-amine. InChIKey: LAXBQQMJQILTHD-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2S |
|---|---|
| Molecular weight | 250.75 g/mol |
| IUPAC name | 5-[(2-chlorophenyl)methylsulfanyl]pyridin-2-amine |
| InChIKey | LAXBQQMJQILTHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CSC2=CN=C(C=C2)N)Cl |
Computed by PubChem (NCBI)