CAS 950058-19-2 is the registry number for 4-(3-Chlorophenyl)-N-cyclopropylthiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-chlorophenyl)-N-cyclopropyl-1,3-thiazol-2-amine (CAS 950058-19-2) is a chemical compound with the molecular formula C12H11ClN2S and a molecular weight of 250.75 g/mol. IUPAC name: 4-(3-chlorophenyl)-N-cyclopropyl-1,3-thiazol-2-amine. InChIKey: STYKTKBMACWRCL-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2S |
|---|---|
| Molecular weight | 250.75 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-N-cyclopropyl-1,3-thiazol-2-amine |
| InChIKey | STYKTKBMACWRCL-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=NC(=CS2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)