CAS 1095544-90-3 is the registry number for 6-Chloro-1,4-dimethylphthalazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1,4-dimethylphthalazine (CAS 1095544-90-3) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 6-chloro-1,4-dimethylphthalazine. InChIKey: XJAMBTMBIAIQGM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 6-chloro-1,4-dimethylphthalazine |
| InChIKey | XJAMBTMBIAIQGM-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=C(N=N1)C)Cl |
Computed by PubChem (NCBI)